C8H10Cl6N2O2S — CID 23579838
2,2,2-trichloro-N-[2-[2-[(2,2,2-trichloroacetyl)amino]ethylsulfanyl]ethyl]acetamide (PubChem CID 23579838) has the molecular formula C8H10Cl6N2O2S and a molecular weight of 410.97 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[2-[2-[(2,2,2-trichloroacetyl)amino]ethylsulfanyl]ethyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[2-[2-[(2,2,2-trichloroacetyl)amino]ethylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 23579838 |
| Molecular Formula | C8H10Cl6N2O2S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 407.86 |
| IUPAC Name | 2,2,2-trichloro-N-[2-[2-[(2,2,2-trichloroacetyl)amino]ethylsulfanyl]ethyl]acetamide |
| SMILES | O=C(NCCSCCNC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10Cl6N2O2S/c9-7(10,11)5(17)15-1-3-19-4-2-16-6(18)8(12,13)14/h1-4H2,(H,15,17)(H,16,18) |
| InChIKey | KJMCRCUYOKLCHX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|