C4H3Cl4NO2 — CID 154016680
2,2,2-trichloro-N-(2-chloroacetyl)acetamide (PubChem CID 154016680) has the molecular formula C4H3Cl4NO2 and a molecular weight of 238.88 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2-chloroacetyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2-chloroacetyl)acetamide |
|---|---|
| PubChem CID | 154016680 |
| Molecular Formula | C4H3Cl4NO2 |
| Molecular Weight | 238.88 g/mol |
| Exact Mass | 236.89 |
| IUPAC Name | 2,2,2-trichloro-N-(2-chloroacetyl)acetamide |
| SMILES | O=C(CCl)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H3Cl4NO2/c5-1-2(10)9-3(11)4(6,7)8/h1H2,(H,9,10,11) |
| InChIKey | VMNNZZHXAOQSPH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.88 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|