C9H19NO2S — CID 103767304
N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-methylpropanamide (PubChem CID 103767304) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-methylpropanamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 103767304 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCSCCCO |
| InChI | InChI=1S/C9H19NO2S/c1-8(2)9(12)10-4-7-13-6-3-5-11/h8,11H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | FKNMRTVTGPDCSM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|