C9H19N3O3S — CID 103950547
2-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]butanediamide (PubChem CID 103950547) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]butanediamide.
| Compound Name | 2-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 103950547 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NCCSCCCO |
| InChI | InChI=1S/C9H19N3O3S/c10-7(6-8(11)14)9(15)12-2-5-16-4-1-3-13/h7,13H,1-6,10H2,(H2,11,14)(H,12,15) |
| InChIKey | DEOMEMSWHLGCCK-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|