C9H20N2O2S — CID 106310997
2-(ethylamino)-N-[2-(3-hydroxypropylsulfanyl)ethyl]acetamide (PubChem CID 106310997) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-(ethylamino)-N-[2-(3-hydroxypropylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(ethylamino)-N-[2-(3-hydroxypropylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 106310997 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(ethylamino)-N-[2-(3-hydroxypropylsulfanyl)ethyl]acetamide |
| SMILES | CCNCC(=O)NCCSCCCO |
| InChI | InChI=1S/C9H20N2O2S/c1-2-10-8-9(13)11-4-7-14-6-3-5-12/h10,12H,2-8H2,1H3,(H,11,13) |
| InChIKey | ASRLAUWGTKZSOG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|