C11H23NO2S — CID 103767537
N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methylpentanamide (PubChem CID 103767537) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methylpentanamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 103767537 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NCCSCCCO |
| InChI | InChI=1S/C11H23NO2S/c1-10(2)4-5-11(14)12-6-9-15-8-3-7-13/h10,13H,3-9H2,1-2H3,(H,12,14) |
| InChIKey | YNTQYTRAWYDHCL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|