C12H26N2O2S — CID 114171847
2-[2-(3-hydroxypropylsulfanyl)ethylamino]-N-pentan-2-ylacetamide (PubChem CID 114171847) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropylsulfanyl)ethylamino]-N-pentan-2-ylacetamide.
| Compound Name | 2-[2-(3-hydroxypropylsulfanyl)ethylamino]-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 114171847 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-[2-(3-hydroxypropylsulfanyl)ethylamino]-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)CNCCSCCCO |
| InChI | InChI=1S/C12H26N2O2S/c1-3-5-11(2)14-12(16)10-13-6-9-17-8-4-7-15/h11,13,15H,3-10H2,1-2H3,(H,14,16) |
| InChIKey | BGQHMFQFFZTPNX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|