C11H18Cl3NO4 — CID 12966162
2,2,2-trichloro-N-[(2S)-2-hydroxy-2-[(2S,5R)-5-[(1S)-1-hydroxypropyl]oxolan-2-yl]ethyl]acetamide (PubChem CID 12966162) has the molecular formula C11H18Cl3NO4 and a molecular weight of 334.63 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2S)-2-hydroxy-2-[(2S,5R)-5-[(1S)-1-hydroxypropyl]oxolan-2-yl]ethyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(2S)-2-hydroxy-2-[(2S,5R)-5-[(1S)-1-hydroxypropyl]oxolan-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 12966162 |
| Molecular Formula | C11H18Cl3NO4 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2,2,2-trichloro-N-[(2S)-2-hydroxy-2-[(2S,5R)-5-[(1S)-1-hydroxypropyl]oxolan-2-yl]ethyl]acetamide |
| SMILES | CC[C@H](O)[C@H]1CC[C@@H]([C@@H](O)CNC(=O)C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C11H18Cl3NO4/c1-2-6(16)8-3-4-9(19-8)7(17)5-15-10(18)11(12,13)14/h6-9,16-17H,2-5H2,1H3,(H,15,18)/t6-,7-,8+,9-/m0/s1 |
| InChIKey | MSBSRYJORJUABN-MAUMQABQSA-N |
| XLogP | 1.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|