C11H21NO5 — CID 123706395
6-(2,2-dimethylpropanoylamino)-3,5-dihydroxyhexanoic acid (PubChem CID 123706395) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is 6-(2,2-dimethylpropanoylamino)-3,5-dihydroxyhexanoic acid.
| Compound Name | 6-(2,2-dimethylpropanoylamino)-3,5-dihydroxyhexanoic acid |
|---|---|
| PubChem CID | 123706395 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 6-(2,2-dimethylpropanoylamino)-3,5-dihydroxyhexanoic acid |
| SMILES | CC(C)(C)C(=O)NCC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C11H21NO5/c1-11(2,3)10(17)12-6-8(14)4-7(13)5-9(15)16/h7-8,13-14H,4-6H2,1-3H3,(H,12,17)(H,15,16) |
| InChIKey | JHVHCNVGAKYYLU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |