C7H12ClF5N2O — CID 140860233
N-(4-aminobutyl)-2,2,3,3,3-pentafluoropropanamide;hydrochloride (PubChem CID 140860233) has the molecular formula C7H12ClF5N2O and a molecular weight of 270.63 g/mol. Its IUPAC name is N-(4-aminobutyl)-2,2,3,3,3-pentafluoropropanamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-2,2,3,3,3-pentafluoropropanamide;hydrochloride |
|---|---|
| PubChem CID | 140860233 |
| Molecular Formula | C7H12ClF5N2O |
| Molecular Weight | 270.63 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | N-(4-aminobutyl)-2,2,3,3,3-pentafluoropropanamide;hydrochloride |
| SMILES | Cl.NCCCCNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H11F5N2O.ClH/c8-6(9,7(10,11)12)5(15)14-4-2-1-3-13;/h1-4,13H2,(H,14,15);1H |
| InChIKey | ONDVSUIUUGOHRK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.63 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|