C9H15F5N2O4S — CID 23563877
2-[methyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]amino]ethanesulfonic acid (PubChem CID 23563877) has the molecular formula C9H15F5N2O4S and a molecular weight of 342.29 g/mol. Its IUPAC name is 2-[methyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]amino]ethanesulfonic acid.
| Compound Name | 2-[methyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 23563877 |
| Molecular Formula | C9H15F5N2O4S |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-[methyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]amino]ethanesulfonic acid |
| SMILES | CN(CCCNC(=O)C(F)(F)C(F)(F)F)CCS(=O)(=O)O |
| InChI | InChI=1S/C9H15F5N2O4S/c1-16(5-6-21(18,19)20)4-2-3-15-7(17)8(10,11)9(12,13)14/h2-6H2,1H3,(H,15,17)(H,18,19,20) |
| InChIKey | GFFVINVRNNMXBV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|