C10H13F10N3O — CID 101146688
3-[bis(trifluoromethyl)amino]-N-[3-(dimethylamino)propyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 101146688) has the molecular formula C10H13F10N3O and a molecular weight of 381.21 g/mol. Its IUPAC name is 3-[bis(trifluoromethyl)amino]-N-[3-(dimethylamino)propyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | 3-[bis(trifluoromethyl)amino]-N-[3-(dimethylamino)propyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 101146688 |
| Molecular Formula | C10H13F10N3O |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-[bis(trifluoromethyl)amino]-N-[3-(dimethylamino)propyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CN(C)CCCNC(=O)C(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F10N3O/c1-22(2)5-3-4-21-6(24)7(11,12)8(13,14)23(9(15,16)17)10(18,19)20/h3-5H2,1-2H3,(H,21,24) |
| InChIKey | VJLNYRVGSPXESA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|