C11H14F10N2O2 — CID 160669563
N-[3-(dimethylamino)propyl]-3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide (PubChem CID 160669563) has the molecular formula C11H14F10N2O2 and a molecular weight of 396.23 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 160669563 |
| Molecular Formula | C11H14F10N2O2 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
| SMILES | CN(C)CCCNC(=O)C(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F10N2O2/c1-23(2)5-3-4-22-7(24)6(8(12,13)14)25-11(20,21)9(15,16)10(17,18)19/h6H,3-5H2,1-2H3,(H,22,24) |
| InChIKey | FSBYCZPXWJDMSG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|