C15H31N5O3 — CID 91693980
2-acetamido-N,N'-bis[3-(dimethylamino)propyl]propanediamide (PubChem CID 91693980) has the molecular formula C15H31N5O3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 2-acetamido-N,N'-bis[3-(dimethylamino)propyl]propanediamide.
| Compound Name | 2-acetamido-N,N'-bis[3-(dimethylamino)propyl]propanediamide |
|---|---|
| PubChem CID | 91693980 |
| Molecular Formula | C15H31N5O3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-acetamido-N,N'-bis[3-(dimethylamino)propyl]propanediamide |
| SMILES | CC(=O)NC(C(=O)NCCCN(C)C)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C15H31N5O3/c1-12(21)18-13(14(22)16-8-6-10-19(2)3)15(23)17-9-7-11-20(4)5/h13H,6-11H2,1-5H3,(H,16,22)(H,17,23)(H,18,21) |
| InChIKey | CVVJJTXWHIZRAO-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|