C19H38N6O4S2 — CID 87759704
N,N'-bis[1-[3-(dimethylamino)propylamino]-1-oxo-3-sulfanylpropan-2-yl]propanediamide (PubChem CID 87759704) has the molecular formula C19H38N6O4S2 and a molecular weight of 478.69 g/mol. Its IUPAC name is N,N'-bis[1-[3-(dimethylamino)propylamino]-1-oxo-3-sulfanylpropan-2-yl]propanediamide.
| Compound Name | N,N'-bis[1-[3-(dimethylamino)propylamino]-1-oxo-3-sulfanylpropan-2-yl]propanediamide |
|---|---|
| PubChem CID | 87759704 |
| Molecular Formula | C19H38N6O4S2 |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N,N'-bis[1-[3-(dimethylamino)propylamino]-1-oxo-3-sulfanylpropan-2-yl]propanediamide |
| SMILES | CN(C)CCCNC(=O)C(CS)NC(=O)CC(=O)NC(CS)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C19H38N6O4S2/c1-24(2)9-5-7-20-18(28)14(12-30)22-16(26)11-17(27)23-15(13-31)19(29)21-8-6-10-25(3)4/h14-15,30-31H,5-13H2,1-4H3,(H,20,28)(H,21,29)(H,22,26)(H,23,27) |
| InChIKey | FHLIVFXJYLQBNT-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|