C20H40N2O3 — CID 118200596
2,2-dimethylpropyl 7-[3-(dimethylamino)propylamino]-2-ethyl-6-methyl-7-oxoheptanoate (PubChem CID 118200596) has the molecular formula C20H40N2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is 2,2-dimethylpropyl 7-[3-(dimethylamino)propylamino]-2-ethyl-6-methyl-7-oxoheptanoate.
| Compound Name | 2,2-dimethylpropyl 7-[3-(dimethylamino)propylamino]-2-ethyl-6-methyl-7-oxoheptanoate |
|---|---|
| PubChem CID | 118200596 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | 2,2-dimethylpropyl 7-[3-(dimethylamino)propylamino]-2-ethyl-6-methyl-7-oxoheptanoate |
| SMILES | CCC(CCCC(C)C(=O)NCCCN(C)C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C20H40N2O3/c1-8-17(19(24)25-15-20(3,4)5)12-9-11-16(2)18(23)21-13-10-14-22(6)7/h16-17H,8-15H2,1-7H3,(H,21,23) |
| InChIKey | KBMDNQGNTWIICM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|