C19H38N2O5 — CID 155627918
2-(2-ethoxyethoxy)ethyl 5-[3-(dimethylamino)propylamino]-2-ethyl-4-methyl-5-oxopentanoate (PubChem CID 155627918) has the molecular formula C19H38N2O5 and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl 5-[3-(dimethylamino)propylamino]-2-ethyl-4-methyl-5-oxopentanoate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl 5-[3-(dimethylamino)propylamino]-2-ethyl-4-methyl-5-oxopentanoate |
|---|---|
| PubChem CID | 155627918 |
| Molecular Formula | C19H38N2O5 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl 5-[3-(dimethylamino)propylamino]-2-ethyl-4-methyl-5-oxopentanoate |
| SMILES | CCOCCOCCOC(=O)C(CC)CC(C)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C19H38N2O5/c1-6-17(19(23)26-14-13-25-12-11-24-7-2)15-16(3)18(22)20-9-8-10-21(4)5/h16-17H,6-15H2,1-5H3,(H,20,22) |
| InChIKey | OPTFJQIPKWTAMU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|