C49H97NO8 — CID 171792506
[2-[4-(dimethylamino)butanoyloxymethyl]-2-(2-ethylheptanoyloxymethyl)-3-(2-pentylheptanoyloxy)propyl] 2-pentylheptanoate;ethane;propane (PubChem CID 171792506) has the molecular formula C49H97NO8 and a molecular weight of 828.31 g/mol. Its IUPAC name is [2-[4-(dimethylamino)butanoyloxymethyl]-2-(2-ethylheptanoyloxymethyl)-3-(2-pentylheptanoyloxy)propyl] 2-pentylheptanoate;ethane;propane.
| Compound Name | [2-[4-(dimethylamino)butanoyloxymethyl]-2-(2-ethylheptanoyloxymethyl)-3-(2-pentylheptanoyloxy)propyl] 2-pentylheptanoate;ethane;propane |
|---|---|
| PubChem CID | 171792506 |
| Molecular Formula | C49H97NO8 |
| Molecular Weight | 828.31 g/mol |
| Exact Mass | 827.72 |
| IUPAC Name | [2-[4-(dimethylamino)butanoyloxymethyl]-2-(2-ethylheptanoyloxymethyl)-3-(2-pentylheptanoyloxy)propyl] 2-pentylheptanoate;ethane;propane |
| SMILES | CC.CCC.CCCCCC(CC)C(=O)OCC(COC(=O)CCCN(C)C)(COC(=O)C(CCCCC)CCCCC)COC(=O)C(CCCCC)CCCCC |
| InChI | InChI=1S/C44H83NO8.C3H8.C2H6/c1-9-15-20-26-37(14-6)41(47)51-34-44(33-50-40(46)31-25-32-45(7)8,35-52-42(48)38(27-21-16-10-2)28-22-17-11-3)36-53-43(49)39(29-23-18-12-4)30-24-19-13-5;1-3-2;1-2/h37-39H,9-36H2,1-8H3;3H2,1-2H3;1-2H3 |
| InChIKey | IGQJERHJBJRYSF-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.31 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|