C23H47N3O2 — CID 20759278
2,2,3,3-tetramethyl-N-[3-[methyl-[3-(2,2,3,3-tetramethylbutanoylamino)propyl]amino]propyl]butanamide (PubChem CID 20759278) has the molecular formula C23H47N3O2 and a molecular weight of 397.65 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N-[3-[methyl-[3-(2,2,3,3-tetramethylbutanoylamino)propyl]amino]propyl]butanamide.
| Compound Name | 2,2,3,3-tetramethyl-N-[3-[methyl-[3-(2,2,3,3-tetramethylbutanoylamino)propyl]amino]propyl]butanamide |
|---|---|
| PubChem CID | 20759278 |
| Molecular Formula | C23H47N3O2 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 397.37 |
| IUPAC Name | 2,2,3,3-tetramethyl-N-[3-[methyl-[3-(2,2,3,3-tetramethylbutanoylamino)propyl]amino]propyl]butanamide |
| SMILES | CN(CCCNC(=O)C(C)(C)C(C)(C)C)CCCNC(=O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H47N3O2/c1-20(2,3)22(7,8)18(27)24-14-12-16-26(11)17-13-15-25-19(28)23(9,10)21(4,5)6/h12-17H2,1-11H3,(H,24,27)(H,25,28) |
| InChIKey | QHCXJRHMSVNPPZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|