C6H5F8NOS — CID 106433423
2,2,3,3,3-pentafluoro-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide (PubChem CID 106433423) has the molecular formula C6H5F8NOS and a molecular weight of 291.16 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 106433423 |
| Molecular Formula | C6H5F8NOS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide |
| SMILES | O=C(NCCSC(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F8NOS/c7-4(8,5(9,10)11)3(16)15-1-2-17-6(12,13)14/h1-2H2,(H,15,16) |
| InChIKey | FZYRVZCGDYSQIA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|