C17H8F15NO5 — CID 600575
[2-[2-(2,2,3,3,3-pentafluoropropanoylamino)-1-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 600575) has the molecular formula C17H8F15NO5 and a molecular weight of 591.22 g/mol. Its IUPAC name is [2-[2-(2,2,3,3,3-pentafluoropropanoylamino)-1-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [2-[2-(2,2,3,3,3-pentafluoropropanoylamino)-1-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 600575 |
| Molecular Formula | C17H8F15NO5 |
| Molecular Weight | 591.22 g/mol |
| Exact Mass | 591.02 |
| IUPAC Name | [2-[2-(2,2,3,3,3-pentafluoropropanoylamino)-1-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(NCC(OC(=O)C(F)(F)C(F)(F)F)c1ccccc1OC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H8F15NO5/c18-12(19,15(24,25)26)9(34)33-5-8(38-11(36)14(22,23)17(30,31)32)6-3-1-2-4-7(6)37-10(35)13(20,21)16(27,28)29/h1-4,8H,5H2,(H,33,34) |
| InChIKey | FUIRASJGOWFDOR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.22 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|