C14H9F10NO3 — CID 622275
[4-[2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 622275) has the molecular formula C14H9F10NO3 and a molecular weight of 429.21 g/mol. Its IUPAC name is [4-[2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 622275 |
| Molecular Formula | C14H9F10NO3 |
| Molecular Weight | 429.21 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | [4-[2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(NCCc1ccc(OC(=O)C(F)(F)C(F)(F)F)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9F10NO3/c15-11(16,13(19,20)21)9(26)25-6-5-7-1-3-8(4-2-7)28-10(27)12(17,18)14(22,23)24/h1-4H,5-6H2,(H,25,26) |
| InChIKey | BGVUHHRQJFVIIW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|