About [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate
[2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate (PubChem CID 154714714) has the molecular formula C10H7F5O2
and a molecular weight of 254.15 g/mol. Its IUPAC name is [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate.
Analyze [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate?
The IUPAC name of [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate (CID 154714714) is [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate?
The canonical SMILES for [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate is O=C(OC(CF)c1ccc(F)cc1)C(F)(F)F.
What is the InChIKey of [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate?
The InChIKey is AIFGBGUKVICZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F5O2/c11-5-8(17-9(16)10(13,14)15)6-1-3-7(12)4-2-6/h1-4,8H,5H2.
What are the key properties of [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate?
[2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate has a molecular weight of 254.15 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-1-(4-fluorophenyl)ethyl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 154714714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).