C14H17F3O2 — CID 132580322
1-[4-(2-methylpropyl)phenyl]ethyl 2,2,2-trifluoroacetate (PubChem CID 132580322) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-[4-(2-methylpropyl)phenyl]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 1-[4-(2-methylpropyl)phenyl]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 132580322 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-[4-(2-methylpropyl)phenyl]ethyl 2,2,2-trifluoroacetate |
| SMILES | CC(C)Cc1ccc(C(C)OC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)19-13(18)14(15,16)17/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | YHBASFVWIPGHPR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |