C11H11F4NO2 — CID 169224463
[3-amino-1-(3-fluorophenyl)propyl] 2,2,2-trifluoroacetate (PubChem CID 169224463) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is [3-amino-1-(3-fluorophenyl)propyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-amino-1-(3-fluorophenyl)propyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 169224463 |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | [3-amino-1-(3-fluorophenyl)propyl] 2,2,2-trifluoroacetate |
| SMILES | NCCC(OC(=O)C(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C11H11F4NO2/c12-8-3-1-2-7(6-8)9(4-5-16)18-10(17)11(13,14)15/h1-3,6,9H,4-5,16H2 |
| InChIKey | PVCGHFHHOVDDHI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |