C30H34O4 — CID 91086978
[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[5-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]propanoate (PubChem CID 91086978) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[5-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]propanoate.
| Compound Name | [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[5-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]propanoate |
|---|---|
| PubChem CID | 91086978 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[5-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]propanoate |
| SMILES | COc1cc(C=Cc2ccc(OC(=O)C(C)C3=CCC=C(CC(C)C)C=C3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C30H34O4/c1-21(2)17-24-7-6-8-26(14-11-24)22(3)30(31)34-27-15-12-23(13-16-27)9-10-25-18-28(32-4)20-29(19-25)33-5/h7-16,18-22H,6,17H2,1-5H3 |
| InChIKey | DAQPCHBWTXYICT-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|