C25H32N2O6 — CID 175930852
3-[(2-amino-3-methylbutanoyl)amino]propyl [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbonate (PubChem CID 175930852) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-[(2-amino-3-methylbutanoyl)amino]propyl [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbonate.
| Compound Name | 3-[(2-amino-3-methylbutanoyl)amino]propyl [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 175930852 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-[(2-amino-3-methylbutanoyl)amino]propyl [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbonate |
| SMILES | COc1cc(C=Cc2ccc(OC(=O)OCCCNC(=O)C(N)C(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C25H32N2O6/c1-17(2)23(26)24(28)27-12-5-13-32-25(29)33-20-10-8-18(9-11-20)6-7-19-14-21(30-3)16-22(15-19)31-4/h6-11,14-17,23H,5,12-13,26H2,1-4H3,(H,27,28) |
| InChIKey | YMYVWXOCGKQODD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|