C37H47N5O8 — CID 11136202
tert-butyl 3-[(2S)-3-[[(1S)-1-formamido-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]ethyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate (PubChem CID 11136202) has the molecular formula C37H47N5O8 and a molecular weight of 689.81 g/mol. Its IUPAC name is tert-butyl 3-[(2S)-3-[[(1S)-1-formamido-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]ethyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2S)-3-[[(1S)-1-formamido-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]ethyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 11136202 |
| Molecular Formula | C37H47N5O8 |
| Molecular Weight | 689.81 g/mol |
| Exact Mass | 689.34 |
| IUPAC Name | tert-butyl 3-[(2S)-3-[[(1S)-1-formamido-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]ethyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)C(=O)N[C@@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)NC=O |
| InChI | InChI=1S/C37H47N5O8/c1-35(2,3)48-32(45)39-27(18-23-20-41(33(46)49-36(4,5)6)28-16-12-10-14-25(23)28)31(44)40-30(38-22-43)19-24-21-42(34(47)50-37(7,8)9)29-17-13-11-15-26(24)29/h10-17,20-22,27,30H,18-19H2,1-9H3,(H,38,43)(H,39,45)(H,40,44)/t27-,30-/m0/s1 |
| InChIKey | RZIKXBALNKAENH-FIBWVYCGSA-N |
| XLogP | 6.03 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|