C28H46N2O6 — CID 54451932
benzyl (3S)-4-(2-decoxyethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 54451932) has the molecular formula C28H46N2O6 and a molecular weight of 506.68 g/mol. Its IUPAC name is benzyl (3S)-4-(2-decoxyethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | benzyl (3S)-4-(2-decoxyethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54451932 |
| Molecular Formula | C28H46N2O6 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | benzyl (3S)-4-(2-decoxyethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | CCCCCCCCCCOCCNC(=O)[C@H](CC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H46N2O6/c1-5-6-7-8-9-10-11-15-19-34-20-18-29-26(32)24(30-27(33)36-28(2,3)4)21-25(31)35-22-23-16-13-12-14-17-23/h12-14,16-17,24H,5-11,15,18-22H2,1-4H3,(H,29,32)(H,30,33)/t24-/m0/s1 |
| InChIKey | WVOAOJSIXRKCJM-DEOSSOPVSA-N |
| XLogP | 5.29 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|