C24H37N3O10 — CID 129175426
methyl 4-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethylamino]-4-oxo-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 129175426) has the molecular formula C24H37N3O10 and a molecular weight of 527.57 g/mol. Its IUPAC name is methyl 4-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethylamino]-4-oxo-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl 4-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethylamino]-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 129175426 |
| Molecular Formula | C24H37N3O10 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | methyl 4-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethylamino]-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)CC(NC(=O)OCc1ccccc1)C(=O)NCCOCCOCCONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H37N3O10/c1-24(2,3)37-23(31)27-36-15-14-34-13-12-33-11-10-25-21(29)19(16-20(28)32-4)26-22(30)35-17-18-8-6-5-7-9-18/h5-9,19H,10-17H2,1-4H3,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | FPIVHQYDYMGIHR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 159.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|