C47H49ClF3N3O5Si — CID 159506299
CID 159506299 (PubChem CID 159506299) has the molecular formula C47H49ClF3N3O5Si and a molecular weight of 856.46 g/mol.
| Compound Name | CID 159506299 |
|---|---|
| PubChem CID | 159506299 |
| Molecular Formula | C47H49ClF3N3O5Si |
| Molecular Weight | 856.46 g/mol |
| Exact Mass | 855.31 |
| IUPAC Name | — |
| SMILES | CN(c1ccccc1)c1ccc2c(c1)[Si](C)(C)c1cc(N(C)c3ccccc3)ccc1[C+]2c1c(F)c(C(=O)NCCOCCOCCCCCCCl)c(F)c(F)c1C(=O)[O-] |
| InChI | InChI=1S/C47H49ClF3N3O5Si/c1-53(31-15-9-7-10-16-31)33-19-21-35-37(29-33)60(3,4)38-30-34(54(2)32-17-11-8-12-18-32)20-22-36(38)39(35)40-41(47(56)57)44(50)45(51)42(43(40)49)46(55)52-24-26-59-28-27-58-25-14-6-5-13-23-48/h7-12,15-22,29-30H,5-6,13-14,23-28H2,1-4H3,(H-,52,55,56,57) |
| InChIKey | MAANSTRNLJJYDP-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.46 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|