C36H47ClN3O5Si+ — CID 71510224
[10-[2-carboxy-5-[2-[2-(5-chloropentoxy)ethoxy]ethylcarbamoyl]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 71510224) has the molecular formula C36H47ClN3O5Si+ and a molecular weight of 665.33 g/mol. Its IUPAC name is [10-[2-carboxy-5-[2-[2-(5-chloropentoxy)ethoxy]ethylcarbamoyl]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-[2-carboxy-5-[2-[2-(5-chloropentoxy)ethoxy]ethylcarbamoyl]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 71510224 |
| Molecular Formula | C36H47ClN3O5Si+ |
| Molecular Weight | 665.33 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | [10-[2-carboxy-5-[2-[2-(5-chloropentoxy)ethoxy]ethylcarbamoyl]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1cc(C(=O)NCCOCCOCCCCCCl)ccc1C(=O)O |
| InChI | InChI=1S/C36H46ClN3O5Si/c1-39(2)26-11-14-29-32(23-26)46(5,6)33-24-27(40(3)4)12-15-30(33)34(29)31-22-25(10-13-28(31)36(42)43)35(41)38-17-19-45-21-20-44-18-9-7-8-16-37/h10-15,22-24H,7-9,16-21H2,1-6H3,(H-,38,41,42,43)/p+1 |
| InChIKey | NMHSAYXGGXQEJP-UHFFFAOYSA-O |
| XLogP | 5.10 |
| TPSA | 91.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|