C38H53N2O6S2Si+ — CID 159202315
[10-(2-carboxyphenyl)-7-(dimethylamino)-5,5-bis[2-[2-(2-methoxyethoxy)ethylsulfanyl]ethyl]benzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 159202315) has the molecular formula C38H53N2O6S2Si+ and a molecular weight of 726.07 g/mol. Its IUPAC name is [10-(2-carboxyphenyl)-7-(dimethylamino)-5,5-bis[2-[2-(2-methoxyethoxy)ethylsulfanyl]ethyl]benzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-(2-carboxyphenyl)-7-(dimethylamino)-5,5-bis[2-[2-(2-methoxyethoxy)ethylsulfanyl]ethyl]benzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 159202315 |
| Molecular Formula | C38H53N2O6S2Si+ |
| Molecular Weight | 726.07 g/mol |
| Exact Mass | 725.31 |
| IUPAC Name | [10-(2-carboxyphenyl)-7-(dimethylamino)-5,5-bis[2-[2-(2-methoxyethoxy)ethylsulfanyl]ethyl]benzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | COCCOCCSCC[Si]1(CCSCCOCCOC)C2=CC(=[N+](C)C)C=CC2=C(c2ccccc2C(=O)O)c2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C38H52N2O6S2Si/c1-39(2)29-11-13-33-35(27-29)49(25-23-47-21-19-45-17-15-43-5,26-24-48-22-20-46-18-16-44-6)36-28-30(40(3)4)12-14-34(36)37(33)31-9-7-8-10-32(31)38(41)42/h7-14,27-28H,15-26H2,1-6H3/p+1 |
| InChIKey | CPOMQHIUDRKFTE-UHFFFAOYSA-O |
| XLogP | 5.46 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.07 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|