C40H59N2Si+ — CID 175876291
[7-(dimethylamino)-10-(2-methylphenyl)-5,5-dioctylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 175876291) has the molecular formula C40H59N2Si+ and a molecular weight of 596.01 g/mol. Its IUPAC name is [7-(dimethylamino)-10-(2-methylphenyl)-5,5-dioctylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [7-(dimethylamino)-10-(2-methylphenyl)-5,5-dioctylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 175876291 |
| Molecular Formula | C40H59N2Si+ |
| Molecular Weight | 596.01 g/mol |
| Exact Mass | 595.44 |
| IUPAC Name | [7-(dimethylamino)-10-(2-methylphenyl)-5,5-dioctylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CCCCCCCC[Si]1(CCCCCCCC)C2=CC(=[N+](C)C)C=CC2=C(c2ccccc2C)c2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C40H59N2Si/c1-8-10-12-14-16-20-28-43(29-21-17-15-13-11-9-2)38-30-33(41(4)5)24-26-36(38)40(35-23-19-18-22-32(35)3)37-27-25-34(42(6)7)31-39(37)43/h18-19,22-27,30-31H,8-17,20-21,28-29H2,1-7H3/q+1 |
| InChIKey | XGQCLPDZYHVSPJ-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.01 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|