C29H29F6N2O+ — CID 178176797
[7-(dimethylamino)-10-(2-methylphenyl)-9,9-bis(trifluoromethyl)anthracen-2-ylidene]-dimethylazanium;ethenol (PubChem CID 178176797) has the molecular formula C29H29F6N2O+ and a molecular weight of 535.55 g/mol. Its IUPAC name is [7-(dimethylamino)-10-(2-methylphenyl)-9,9-bis(trifluoromethyl)anthracen-2-ylidene]-dimethylazanium;ethenol.
| Compound Name | [7-(dimethylamino)-10-(2-methylphenyl)-9,9-bis(trifluoromethyl)anthracen-2-ylidene]-dimethylazanium;ethenol |
|---|---|
| PubChem CID | 178176797 |
| Molecular Formula | C29H29F6N2O+ |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | [7-(dimethylamino)-10-(2-methylphenyl)-9,9-bis(trifluoromethyl)anthracen-2-ylidene]-dimethylazanium;ethenol |
| SMILES | C=CO.Cc1ccccc1C1=C2C=CC(=[N+](C)C)C=C2C(C(F)(F)F)(C(F)(F)F)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C27H25F6N2.C2H4O/c1-16-8-6-7-9-19(16)24-20-12-10-17(34(2)3)14-22(20)25(26(28,29)30,27(31,32)33)23-15-18(35(4)5)11-13-21(23)24;1-2-3/h6-15H,1-5H3;2-3H,1H2/q+1; |
| InChIKey | UTCCMLCNNCOZQL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|