C37H41N4O5+ — CID 123350482
[7-(dimethylamino)-10-[2-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpiperidine-1-carbonyl]phenyl]-9,9-dimethylanthracen-2-ylidene]-dimethylazanium (PubChem CID 123350482) has the molecular formula C37H41N4O5+ and a molecular weight of 621.76 g/mol. Its IUPAC name is [7-(dimethylamino)-10-[2-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpiperidine-1-carbonyl]phenyl]-9,9-dimethylanthracen-2-ylidene]-dimethylazanium.
| Compound Name | [7-(dimethylamino)-10-[2-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpiperidine-1-carbonyl]phenyl]-9,9-dimethylanthracen-2-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 123350482 |
| Molecular Formula | C37H41N4O5+ |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | [7-(dimethylamino)-10-[2-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpiperidine-1-carbonyl]phenyl]-9,9-dimethylanthracen-2-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)C(C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1ccccc1C(=O)N1CCC(C(=O)ON2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C37H41N4O5/c1-37(2)30-21-24(38(3)4)11-13-28(30)34(29-14-12-25(39(5)6)22-31(29)37)26-9-7-8-10-27(26)35(44)40-19-17-23(18-20-40)36(45)46-41-32(42)15-16-33(41)43/h7-14,21-23H,15-20H2,1-6H3/q+1 |
| InChIKey | HONGAMOPXAVQRG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|