C30H35N2O4SSi+ — CID 176584936
[(5R)-5-[3-(carboxymethylsulfanyl)propyl]-10-(2-carboxyphenyl)-7-(dimethylamino)-5-methylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 176584936) has the molecular formula C30H35N2O4SSi+ and a molecular weight of 547.77 g/mol. Its IUPAC name is [(5R)-5-[3-(carboxymethylsulfanyl)propyl]-10-(2-carboxyphenyl)-7-(dimethylamino)-5-methylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [(5R)-5-[3-(carboxymethylsulfanyl)propyl]-10-(2-carboxyphenyl)-7-(dimethylamino)-5-methylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 176584936 |
| Molecular Formula | C30H35N2O4SSi+ |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | [(5R)-5-[3-(carboxymethylsulfanyl)propyl]-10-(2-carboxyphenyl)-7-(dimethylamino)-5-methylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)[Si@@](C)(CCCSCC(=O)O)C1=CC(=[N+](C)C)C=CC1=C2c1ccccc1C(=O)O |
| InChI | InChI=1S/C30H34N2O4SSi/c1-31(2)20-11-13-24-26(17-20)38(5,16-8-15-37-19-28(33)34)27-18-21(32(3)4)12-14-25(27)29(24)22-9-6-7-10-23(22)30(35)36/h6-7,9-14,17-18H,8,15-16,19H2,1-5H3,(H-,33,34,35,36)/p+1 |
| InChIKey | HJXZNWXBPSFREG-UHFFFAOYSA-O |
| XLogP | 4.51 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|