C29H32N2O4Si — CID 153280603
4-[[2-[7-(dimethylamino)-5,5-dimethyl-3-oxobenzo[b][1]benzosilin-10-yl]benzoyl]-methylamino]butanoic acid (PubChem CID 153280603) has the molecular formula C29H32N2O4Si and a molecular weight of 500.67 g/mol. Its IUPAC name is 4-[[2-[7-(dimethylamino)-5,5-dimethyl-3-oxobenzo[b][1]benzosilin-10-yl]benzoyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-[7-(dimethylamino)-5,5-dimethyl-3-oxobenzo[b][1]benzosilin-10-yl]benzoyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 153280603 |
| Molecular Formula | C29H32N2O4Si |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 4-[[2-[7-(dimethylamino)-5,5-dimethyl-3-oxobenzo[b][1]benzosilin-10-yl]benzoyl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)c1ccccc1C1=C2C=CC(=O)C=C2[Si](C)(C)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C29H32N2O4Si/c1-30(2)19-12-14-23-25(17-19)36(4,5)26-18-20(32)13-15-24(26)28(23)21-9-6-7-10-22(21)29(35)31(3)16-8-11-27(33)34/h6-7,9-10,12-15,17-18H,8,11,16H2,1-5H3,(H,33,34) |
| InChIKey | LXTFHBMPCYEHTJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|