C30H38N3O4SSi+ — CID 86270299
[10-[4-(3-carboxypropylsulfamoyl)-2-methylphenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 86270299) has the molecular formula C30H38N3O4SSi+ and a molecular weight of 564.80 g/mol. Its IUPAC name is [10-[4-(3-carboxypropylsulfamoyl)-2-methylphenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-[4-(3-carboxypropylsulfamoyl)-2-methylphenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 86270299 |
| Molecular Formula | C30H38N3O4SSi+ |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | [10-[4-(3-carboxypropylsulfamoyl)-2-methylphenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | Cc1cc(S(=O)(=O)NCCCC(=O)O)ccc1C1=C2C=CC(=[N+](C)C)C=C2[Si](C)(C)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C30H37N3O4SSi/c1-20-17-23(38(36,37)31-16-8-9-29(34)35)12-15-24(20)30-25-13-10-21(32(2)3)18-27(25)39(6,7)28-19-22(33(4)5)11-14-26(28)30/h10-15,17-19,31H,8-9,16H2,1-7H3/p+1 |
| InChIKey | AAEBHIANIANRSA-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|