C33H40F3N2O2Si+ — CID 158857080
[10-[2-carboxy-5-(2,2-dimethylpentan-3-yl)-3,4,6-trifluorophenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 158857080) has the molecular formula C33H40F3N2O2Si+ and a molecular weight of 581.78 g/mol. Its IUPAC name is [10-[2-carboxy-5-(2,2-dimethylpentan-3-yl)-3,4,6-trifluorophenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-[2-carboxy-5-(2,2-dimethylpentan-3-yl)-3,4,6-trifluorophenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 158857080 |
| Molecular Formula | C33H40F3N2O2Si+ |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | [10-[2-carboxy-5-(2,2-dimethylpentan-3-yl)-3,4,6-trifluorophenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CCC(c1c(F)c(F)c(C(=O)O)c(C2=C3C=CC(=[N+](C)C)C=C3[Si](C)(C)c3cc(N(C)C)ccc32)c1F)C(C)(C)C |
| InChI | InChI=1S/C33H39F3N2O2Si/c1-11-22(33(2,3)4)26-29(34)27(28(32(39)40)31(36)30(26)35)25-20-14-12-18(37(5)6)16-23(20)41(9,10)24-17-19(38(7)8)13-15-21(24)25/h12-17,22H,11H2,1-10H3/p+1 |
| InChIKey | SGXHCZCBDBIRPF-UHFFFAOYSA-O |
| XLogP | 6.89 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|