C26H28N2O4SSi — CID 140657528
2-carboxy-4-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-5-methylthiophene-3-carboxylate (PubChem CID 140657528) has the molecular formula C26H28N2O4SSi and a molecular weight of 492.67 g/mol. Its IUPAC name is 2-carboxy-4-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-5-methylthiophene-3-carboxylate.
| Compound Name | 2-carboxy-4-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 140657528 |
| Molecular Formula | C26H28N2O4SSi |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-carboxy-4-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-5-methylthiophene-3-carboxylate |
| SMILES | Cc1sc(C(=O)O)c(C(=O)[O-])c1C1=C2C=CC(=[N+](C)C)C=C2[Si](C)(C)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C26H28N2O4SSi/c1-14-21(23(25(29)30)24(33-14)26(31)32)22-17-10-8-15(27(2)3)12-19(17)34(6,7)20-13-16(28(4)5)9-11-18(20)22/h8-13H,1-7H3,(H-,29,30,31,32) |
| InChIKey | BAMGGOHYKYLBLL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|