C27H32BrN2Si+ — CID 155760899
[10-(5-bromo-2,4-dimethylphenyl)-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 155760899) has the molecular formula C27H32BrN2Si+ and a molecular weight of 492.56 g/mol. Its IUPAC name is [10-(5-bromo-2,4-dimethylphenyl)-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-(5-bromo-2,4-dimethylphenyl)-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 155760899 |
| Molecular Formula | C27H32BrN2Si+ |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [10-(5-bromo-2,4-dimethylphenyl)-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | Cc1cc(C)c(C2=C3C=CC(=[N+](C)C)C=C3[Si](C)(C)c3cc(N(C)C)ccc32)cc1Br |
| InChI | InChI=1S/C27H32BrN2Si/c1-17-13-18(2)24(28)16-23(17)27-21-11-9-19(29(3)4)14-25(21)31(7,8)26-15-20(30(5)6)10-12-22(26)27/h9-16H,1-8H3/q+1 |
| InChIKey | SHRGHEWEDAWUBB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|