C29H36N3OSi+ — CID 160652370
[7-(dimethylamino)-10-[5-(ethylcarbamoyl)-2-methylphenyl]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 160652370) has the molecular formula C29H36N3OSi+ and a molecular weight of 470.71 g/mol. Its IUPAC name is [7-(dimethylamino)-10-[5-(ethylcarbamoyl)-2-methylphenyl]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [7-(dimethylamino)-10-[5-(ethylcarbamoyl)-2-methylphenyl]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 160652370 |
| Molecular Formula | C29H36N3OSi+ |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | [7-(dimethylamino)-10-[5-(ethylcarbamoyl)-2-methylphenyl]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CCNC(=O)c1ccc(C)c(C2=C3C=CC(=[N+](C)C)C=C3[Si](C)(C)c3cc(N(C)C)ccc32)c1 |
| InChI | InChI=1S/C29H35N3OSi/c1-9-30-29(33)20-11-10-19(2)25(16-20)28-23-14-12-21(31(3)4)17-26(23)34(7,8)27-18-22(32(5)6)13-15-24(27)28/h10-18H,9H2,1-8H3/p+1 |
| InChIKey | RKPBTXPPIZQVIE-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 35.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|