C40H47N4O7Si+ — CID 158335096
[10-[2-carboxy-5-[2-[2-[3-(2-nitrophenyl)propoxy]ethoxy]ethylcarbamoyl]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 158335096) has the molecular formula C40H47N4O7Si+ and a molecular weight of 723.92 g/mol. Its IUPAC name is [10-[2-carboxy-5-[2-[2-[3-(2-nitrophenyl)propoxy]ethoxy]ethylcarbamoyl]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-[2-carboxy-5-[2-[2-[3-(2-nitrophenyl)propoxy]ethoxy]ethylcarbamoyl]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 158335096 |
| Molecular Formula | C40H47N4O7Si+ |
| Molecular Weight | 723.92 g/mol |
| Exact Mass | 723.32 |
| IUPAC Name | [10-[2-carboxy-5-[2-[2-[3-(2-nitrophenyl)propoxy]ethoxy]ethylcarbamoyl]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1cc(C(=O)NCCOCCOCCCc2ccccc2[N+](=O)[O-])ccc1C(=O)O |
| InChI | InChI=1S/C40H46N4O7Si/c1-42(2)29-14-17-32-36(25-29)52(5,6)37-26-30(43(3)4)15-18-33(37)38(32)34-24-28(13-16-31(34)40(46)47)39(45)41-19-21-51-23-22-50-20-9-11-27-10-7-8-12-35(27)44(48)49/h7-8,10,12-18,24-26H,9,11,19-23H2,1-6H3,(H-,41,45,46,47)/p+1 |
| InChIKey | IZKSMBPBNAMAPS-UHFFFAOYSA-O |
| XLogP | 5.23 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|