C78H102B2N5O14Si+ — CID 161404489
CID 161404489 (PubChem CID 161404489) has the molecular formula C78H102B2N5O14Si+ and a molecular weight of 1383.40 g/mol.
| Compound Name | CID 161404489 |
|---|---|
| PubChem CID | 161404489 |
| Molecular Formula | C78H102B2N5O14Si+ |
| Molecular Weight | 1383.40 g/mol |
| Exact Mass | 1382.74 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)CCCOCCOCCOCCOCCN(Cc1ccccc1O[B]O)Cc1c2ccccc2c(CN(CCOCCOCCOCCOCCNC(=O)C(=C)C)Cc2ccccc2O[B]O)c2ccc(C3=C4C=CC(=[N+](C)C)C=C4[Si](C)(C)c4cc(N(C)C)ccc43)cc12 |
| InChI | InChI=1S/C78H101B2N5O14Si/c1-57(2)72(86)22-17-34-90-38-42-94-46-48-96-45-41-93-37-33-85(54-61-19-12-16-24-74(61)99-80-89)56-71-65-21-14-13-20-64(65)70(55-84(53-60-18-11-15-23-73(60)98-79-88)32-36-92-40-44-97-49-47-95-43-39-91-35-31-81-78(87)58(3)4)66-28-25-59(50-69(66)71)77-67-29-26-62(82(5)6)51-75(67)100(9,10)76-52-63(83(7)8)27-30-68(76)77/h11-16,18-21,23-30,50-52,88-89H,1,3,17,22,31-49,53-56H2,2,4-10H3/p+1 |
| InChIKey | FPQWLBCAGCOQKW-UHFFFAOYSA-O |
| XLogP | 9.10 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 100 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1383.40 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|