C67H71B2F3N6O8Si — CID 158844178
CID 158844178 (PubChem CID 158844178) has the molecular formula C67H71B2F3N6O8Si and a molecular weight of 1195.04 g/mol.
| Compound Name | CID 158844178 |
|---|---|
| PubChem CID | 158844178 |
| Molecular Formula | C67H71B2F3N6O8Si |
| Molecular Weight | 1195.04 g/mol |
| Exact Mass | 1194.52 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)NCCCNC(=O)c1cc(C2=C3C=CC(=[N+](C)C)C=C3[Si](C)(C)c3cc(N(C)C)ccc32)cc(-c2ccc3c(CN(C)Cc4ccccc4O[B]O)c4ccccc4c(CN(C)Cc4ccccc4O[B]O)c3c2)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C65H70B2N6O6Si.C2HF3O2/c1-42(2)64(74)68-30-17-31-69-65(75)48-33-46(32-47(34-48)63-54-28-25-49(70(3)4)36-61(54)80(9,10)62-37-50(71(5)6)26-29-55(62)63)43-24-27-53-56(35-43)58(41-73(8)39-45-19-12-16-23-60(45)79-67-77)52-21-14-13-20-51(52)57(53)40-72(7)38-44-18-11-15-22-59(44)78-66-76;3-2(4,5)1(6)7/h11-16,18-29,32-37,76-77H,1,17,30-31,38-41H2,2-10H3,(H-,68,69,74,75);(H,6,7) |
| InChIKey | UHLWHZCFJSRFOJ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1195.04 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|