About CID 158844178
CID 158844178 (PubChem CID 158844178) has the molecular formula C67H71B2F3N6O8Si
and a molecular weight of 1195.04 g/mol.
Molecular Properties
| Compound Name | CID 158844178 |
| PubChem CID | 158844178 |
| Molecular Formula | C67H71B2F3N6O8Si |
| Molecular Weight | 1195.04 g/mol |
| Exact Mass | 1194.52 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)NCCCNC(=O)c1cc(C2=C3C=CC(=[N+](C)C)C=C3[Si](C)(C)c3cc(N(C)C)ccc32)cc(-c2ccc3c(CN(C)Cc4ccccc4O[B]O)c4ccccc4c(CN(C)Cc4ccccc4O[B]O)c3c2)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C65H70B2N6O6Si.C2HF3O2/c1-42(2)64(74)68-30-17-31-69-65(75)48-33-46(32-47(34-48)63-54-28-25-49(70(3)4)36-61(54)80(9,10)62-37-50(71(5)6)26-29-55(62)63)43-24-27-53-56(35-43)58(41-73(8)39-45-19-12-16-23-60(45)79-67-77)52-21-14-13-20-51(52)57(53)40-72(7)38-44-18-11-15-22-59(44)78-66-76;3-2(4,5)1(6)7/h11-16,18-29,32-37,76-77H,1,17,30-31,38-41H2,2-10H3,(H-,68,69,74,75);(H,6,7) |
| InChIKey | UHLWHZCFJSRFOJ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 87 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1195.04 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 158844178 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158844178?
The IUPAC name of CID 158844178 (CID 158844178) is not available.
What is the SMILES notation for CID 158844178?
The canonical SMILES for CID 158844178 is C=C(C)C(=O)NCCCNC(=O)c1cc(C2=C3C=CC(=[N+](C)C)C=C3[Si](C)(C)c3cc(N(C)C)ccc32)cc(-c2ccc3c(CN(C)Cc4ccccc4O[B]O)c4ccccc4c(CN(C)Cc4ccccc4O[B]O)c3c2)c1.O=C([O-])C(F)(F)F.
What is the InChIKey of CID 158844178?
The InChIKey is UHLWHZCFJSRFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C65H70B2N6O6Si.C2HF3O2/c1-42(2)64(74)68-30-17-31-69-65(75)48-33-46(32-47(34-48)63-54-28-25-49(70(3)4)36-61(54)80(9,10)62-37-50(71(5)6)26-29-55(62)63)43-24-27-53-56(35-43)58(41-73(8)39-45-19-12-16-23-60(45)79-67-77)52-21-14-13-20-51(52)57(53)40-72(7)38-44-18-11-15-22-59(44)78-66-76;3-2(4,5)1(6)7/h11-16,18-29,32-37,76-77H,1,17,30-31,38-41H2,2-10H3,(H-,68,69,74,75);(H,6,7).
What are the key properties of CID 158844178?
CID 158844178 has a molecular weight of 1195.04 g/mol, XLogP of 8.39, 21 rotatable bonds, 4 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158844178 is sourced from PubChem (CID 158844178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).