C28H32N2O3Si — CID 86305950
4-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3-(2-hydroxyethyl)benzoate (PubChem CID 86305950) has the molecular formula C28H32N2O3Si and a molecular weight of 472.66 g/mol. Its IUPAC name is 4-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3-(2-hydroxyethyl)benzoate.
| Compound Name | 4-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3-(2-hydroxyethyl)benzoate |
|---|---|
| PubChem CID | 86305950 |
| Molecular Formula | C28H32N2O3Si |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3-(2-hydroxyethyl)benzoate |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1ccc(C(=O)[O-])cc1CCO |
| InChI | InChI=1S/C28H32N2O3Si/c1-29(2)20-8-11-23-25(16-20)34(5,6)26-17-21(30(3)4)9-12-24(26)27(23)22-10-7-19(28(32)33)15-18(22)13-14-31/h7-12,15-17,31H,13-14H2,1-6H3 |
| InChIKey | WKVVAHVZQAERSU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|