C32H36N3O6SSi+ — CID 86269522
[10-[2-carboxy-4-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]thiophen-3-yl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 86269522) has the molecular formula C32H36N3O6SSi+ and a molecular weight of 618.81 g/mol. Its IUPAC name is [10-[2-carboxy-4-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]thiophen-3-yl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-[2-carboxy-4-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]thiophen-3-yl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 86269522 |
| Molecular Formula | C32H36N3O6SSi+ |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | [10-[2-carboxy-4-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]thiophen-3-yl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1c(CCCC(=O)ON2C(=O)CCC2=O)csc1C(=O)O |
| InChI | InChI=1S/C32H35N3O6SSi/c1-33(2)20-10-12-22-24(16-20)43(5,6)25-17-21(34(3)4)11-13-23(25)30(22)29-19(18-42-31(29)32(39)40)8-7-9-28(38)41-35-26(36)14-15-27(35)37/h10-13,16-18H,7-9,14-15H2,1-6H3/p+1 |
| InChIKey | WSQINVUZFVHRJX-UHFFFAOYSA-O |
| XLogP | 3.92 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|