C34H37N3O6SSi — CID 176584925
2-[(5S)-7-(dimethylamino)-3-dimethylazaniumylidene-5-[3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]sulfanylpropyl]-5-methylbenzo[b][1]benzosilin-10-yl]benzoate (PubChem CID 176584925) has the molecular formula C34H37N3O6SSi and a molecular weight of 643.84 g/mol. Its IUPAC name is 2-[(5S)-7-(dimethylamino)-3-dimethylazaniumylidene-5-[3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]sulfanylpropyl]-5-methylbenzo[b][1]benzosilin-10-yl]benzoate.
| Compound Name | 2-[(5S)-7-(dimethylamino)-3-dimethylazaniumylidene-5-[3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]sulfanylpropyl]-5-methylbenzo[b][1]benzosilin-10-yl]benzoate |
|---|---|
| PubChem CID | 176584925 |
| Molecular Formula | C34H37N3O6SSi |
| Molecular Weight | 643.84 g/mol |
| Exact Mass | 643.22 |
| IUPAC Name | 2-[(5S)-7-(dimethylamino)-3-dimethylazaniumylidene-5-[3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]sulfanylpropyl]-5-methylbenzo[b][1]benzosilin-10-yl]benzoate |
| SMILES | CN(C)c1ccc2c(c1)[Si@](C)(CCCSCC(=O)ON1C(=O)CCC1=O)C1=CC(=[N+](C)C)C=CC1=C2c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C34H37N3O6SSi/c1-35(2)22-11-13-26-28(19-22)45(5,18-8-17-44-21-32(40)43-37-30(38)15-16-31(37)39)29-20-23(36(3)4)12-14-27(29)33(26)24-9-6-7-10-25(24)34(41)42/h6-7,9-14,19-20H,8,15-18,21H2,1-5H3 |
| InChIKey | HIVUYNSFUWJALQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.84 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|