C26H25F3N5O2Si+ — CID 158708384
[10-(5-azido-2-carboxy-3,4,6-trifluorophenyl)-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 158708384) has the molecular formula C26H25F3N5O2Si+ and a molecular weight of 524.60 g/mol. Its IUPAC name is [10-(5-azido-2-carboxy-3,4,6-trifluorophenyl)-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-(5-azido-2-carboxy-3,4,6-trifluorophenyl)-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 158708384 |
| Molecular Formula | C26H25F3N5O2Si+ |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | [10-(5-azido-2-carboxy-3,4,6-trifluorophenyl)-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1c(F)c(N=[N+]=[N-])c(F)c(F)c1C(=O)O |
| InChI | InChI=1S/C26H24F3N5O2Si/c1-33(2)13-7-9-15-17(11-13)37(5,6)18-12-14(34(3)4)8-10-16(18)19(15)20-21(26(35)36)22(27)24(29)25(23(20)28)31-32-30/h7-12H,1-6H3/p+1 |
| InChIKey | IIKIFUFWCBOAGO-UHFFFAOYSA-O |
| XLogP | 5.29 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|